Drugs present in MMsINC which are similar to the molecule MMscode: MMs01995199
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725691![]() | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.77 |
MMs01725517![]() | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.77 |
MMs01726667![]() | O(C)c1cc2c(cc1OC)CCNC2CC1CC2N(CC1CC)CCc1cc(OC)c(OC)cc12 | 0.75 |
MMs01726665![]() | O(C)c1cc2c(cc1OC)CCNC2CC1CC2N(CC1CC)CCc1cc(OC)c(OC)cc12 | 0.75 |
MMs01725838![]() | O(C)c1cc2C34C(C(N(CC3)C)Cc2cc1)CCCC4 | 0.73 |
MMs01725623![]() | S(=O)(=O)(C)c1cc(C(=O)NCCN(CC)CC)c(OC)cc1 | 0.72 |
MMs01724780![]() | O(C)c1ccccc1CC(NC)C | 0.72 |
MMs01725116![]() | O(C)c1ccccc1CC(NC)C | 0.72 |
MMs01725384![]() | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.72 |
MMs01725219![]() | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.72 |












