Drugs present in MMsINC which are similar to the molecule MMscode: MMs01989463
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725860![]() | OC(=O)\C=C\c1nc(ccc1)/C(=C\CN1CCCC1)/c1ccc(cc1)C | 0.72 |
MMs01724766![]() | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.71 |
MMs01725096![]() | Clc1ccc(cc1)C(=O)c1n(C)c(cc1C)CC(O)=O | 0.71 |
MMs01727057![]() | Clc1cc2nc(ccc2cc1)\C=C\c1cc(ccc1)C(SCC1(CC1)CC(O)=O)CCc1ccccc1C(O)(C)C | 0.70 |
MMs01727059![]() | Clc1cc2nc(ccc2cc1)\C=C\c1cc(ccc1)C(SCC1(CC1)CC(O)=O)CCc1ccccc1C(O)(C)C | 0.70 |