Drugs present in MMsINC which are similar to the molecule MMscode: MMs01976448
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724907 | Clc1cc2c(-n3c(CN=C2c2ccccc2F)c[nH+]c3C)cc1 | 0.78 |
MMs01726741 | [n+]12c(n(N=Nn3c4[n+](cccc4)c(C)c3-c3ccccc3)c(-c3ccccc3)c1C)cccc2 | 0.76 |
MMs01724884 | Clc1cc2c(-n3c(nnc3)CN=C2c2ccccc2)cc1 | 0.74 |
MMs01724834 | Clc1cc2c(-n3c(nnc3C)CN=C2c2ccccc2)cc1 | 0.73 |
MMs01725089 | Clc1ccc(cc1)-c1c(nc(nc1N)N)CC | 0.73 |
MMs01725100 | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.72 |
MMs01725102 | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.72 |
MMs01725012 | Clc1c(cccc1Cl)-c1nnc(nc1N)N | 0.70 |
MMs01725241 | Clc1cc(Cl)ccc1C(OCc1ccc(Cl)cc1Cl)Cn1ccnc1 | 0.70 |
MMs01725313 | Clc1cc(Cl)ccc1C(OCc1ccc(Cl)cc1Cl)Cn1ccnc1 | 0.70 |