Drugs present in MMsINC which are similar to the molecule MMscode: MMs01889076
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725463![]() | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.72 |
MMs01725461![]() | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.72 |
MMs01725530![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.72 |
MMs01725532![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.72 |
MMs01725143![]() | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.71 |
MMs01724784![]() | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.71 |
MMs01725457![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.71 |
MMs01725459![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.71 |
MMs01725840![]() | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |
MMs01724749![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.71 |
MMs01725104![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.71 |