Drugs present in MMsINC which are similar to the molecule MMscode: MMs01880604
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727233 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.71 |
MMs01727235 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.71 |
MMs01727237 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.71 |
MMs01727239 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.71 |
MMs01725215 | O=C1N(N=NN1CC)CCN1CCC(N(C(=O)CC)c2ccccc2)(CC1)COC | 0.70 |