Drugs present in MMsINC which are similar to the molecule MMscode: MMs01877787
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.76 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.76 |
MMs01725123 | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.74 |
MMs01725448 | Oc1cc(ccc1O)CC(N)C(O)=O | 0.73 |
MMs01726866 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.72 |
MMs01726865 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.72 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.71 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.71 |