Drugs present in MMsINC which are similar to the molecule MMscode: MMs01865316
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726849![]() | Ic1c(CNC(=O)C)c(I)c(NC(=O)C)c(I)c1C(O)=O | 0.73 |
MMs01726828![]() | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2CO | 0.72 |
MMs01725771![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.71 |
MMs01725455![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.71 |
MMs01725866![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.71 |
MMs01725483![]() | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)C | 0.70 |
MMs01725472![]() | ClC=1CSC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.70 |
MMs01725470![]() | ClC=1CSC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.70 |
MMs01726195![]() | ClC=1CSC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.70 |
MMs01725474![]() | S1C2N(C(=O)C2NC(=O)C(N)c2ccc(O)cc2)C(C(O)=O)=C(C1)C | 0.70 |
MMs01725477![]() | S1C2N(C(=O)C2NC(=O)C(N)c2ccc(O)cc2)C(C(O)=O)=C(C1)\C=C\C | 0.70 |
MMs01726197![]() | S1C2N(C(=O)C2NC(=O)C(N)c2ccc(O)cc2)C(C(O)=O)=C(C1)C | 0.70 |
MMs01725737![]() | S1C2N(C(=O)C2NC(=O)C(N)c2ccc(O)cc2)C(C(O)=O)=C(C1)\C=C\C | 0.70 |
MMs01726199![]() | S1C2N(C(=O)C2NC(=O)C(N)c2ccc(O)cc2)C(C(O)=O)=C(C1)C | 0.70 |
MMs01725861![]() | S1C2N(C(=O)C2NC(=O)C(N)c2ccc(O)cc2)C(C(O)=O)=C(C1)\C=C\C | 0.70 |