Drugs present in MMsINC which are similar to the molecule MMscode: MMs01832752
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725251 | O=C1N(C)C(=O)N(c2nc(n(c12)CCN(CCO)CC)Cc1ccccc1)C | 0.72 |
MMs01726741 | [n+]12c(n(N=Nn3c4[n+](cccc4)c(C)c3-c3ccccc3)c(-c3ccccc3)c1C)cccc2 | 0.71 |
MMs01725213 | Fc1ccc(cc1)Cn1c2c(nc1NC1CCN(CC1)CCc1ccc(OC)cc1)cccc2 | 0.71 |
MMs01725013 | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.71 |
MMs01725694 | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.71 |
MMs01724941 | Clc1ccc2nsnc2c1NC1=[NH+]CCN1 | 0.70 |