Drugs present in MMsINC which are similar to the molecule MMscode: MMs01778976
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725123![]() | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.73 |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.72 |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.72 |
MMs01725448![]() | Oc1cc(ccc1O)CC(N)C(O)=O | 0.72 |
MMs01726865![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.70 |
MMs01726866![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.70 |








