Drugs present in MMsINC which are similar to the molecule MMscode: MMs01771382
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727556 | O1C(CN)C(O)C(O)C(O)C1OC1C(O)C(OC2OC(CO)C(O)C(N)C2O)C(NC(=O)C(O)CCN)CC1N | 0.75 |
MMs01727554 | O1C(CN)C(O)C(O)C(O)C1OC1C(O)C(OC2OC(CO)C(O)C(N)C2O)C(NC(=O)C(O)CCN)CC1N | 0.75 |
MMs01727552 | O1C(CN)C(O)C(O)C(O)C1OC1C(O)C(OC2OC(CO)C(O)C(N)C2O)C(NC(=O)C(O)CCN)CC1N | 0.75 |
MMs01727550 | O1C(CN)C(O)C(O)C(O)C1OC1C(O)C(OC2OC(CO)C(O)C(N)C2O)C(NC(=O)C(O)CCN)CC1N | 0.75 |
MMs01726014 | O1C(OC2C(N)C(O)C(OC)C(N(C(=O)CN)C)C2O)C(N)CCC1C(N)C | 0.72 |
MMs01726016 | O1C(OC2C(N)C(O)C(OC)C(N(C(=O)CN)C)C2O)C(N)CCC1C(N)C | 0.72 |
MMs01726018 | O1C(OC2C(N)C(O)C(OC)C(N(C(=O)CN)C)C2O)C(N)CCC1C(N)C | 0.72 |
MMs01726019 | O1C(OC2C(N)C(O)C(OC)C(N(C(=O)CN)C)C2O)C(N)CCC1C(N)C | 0.72 |
MMs01727372 | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.70 |
MMs01727371 | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.70 |
MMs01727369 | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.70 |
MMs01727367 | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.70 |