Drugs present in MMsINC which are similar to the molecule MMscode: MMs01769507
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726782 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.80 |
MMs01726784 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.80 |
MMs01724792 | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.78 |
MMs01725796 | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.78 |
MMs01727428 | S1c2c(N(c3c1cccc3)CCCN1CCN(CC1)C)cc(S(=O)(=O)N(C)C)cc2 | 0.76 |
MMs01725177 | S1c2c(N(c3c1cccc3)CCCN1CCN(CC1)C)cc(SCC)cc2 | 0.71 |
MMs01727381 | S(=O)(CCC1C(=O)N(N(C1=O)c1ccccc1)c1ccccc1)c1ccccc1 | 0.71 |
MMs01725055 | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.71 |