Drugs present in MMsINC which are similar to the molecule MMscode: MMs01736367
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727470 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.78 |
MMs01727472 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.78 |
MMs01726849 | Ic1c(CNC(=O)C)c(I)c(NC(=O)C)c(I)c1C(O)=O | 0.76 |
MMs01724841 | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.73 |
MMs01724849 | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.71 |
MMs01726828 | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2CO | 0.70 |