Drugs present in MMsINC which are similar to the molecule MMscode: MMs01727724
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727726 | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 1.00 |
MMs01727723 | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 1.00 |
MMs01727724 | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 1.00 |
MMs01727725 | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 1.00 |
MMs01726122 | O1C2(C(OC1CCC)CC1C3C(C4(C(=CC(=O)C=C4)CC3)C)C(O)CC12C)C(=O)CO | 0.73 |
MMs01726123 | O1C2(C(OC1CCC)CC1C3C(C4(C(=CC(=O)C=C4)CC3)C)C(O)CC12C)C(=O)CO | 0.73 |
MMs01726124 | O1C2(C(OC1CCC)CC1C3C(C4(C(=CC(=O)C=C4)CC3)C)C(O)CC12C)C(=O)CO | 0.73 |
MMs01726125 | O1C2(C(OC1CCC)CC1C3C(C4(C(=CC(=O)C=C4)CC3)C)C(O)CC12C)C(=O)CO | 0.73 |