Drugs present in MMsINC which are similar to the molecule MMscode: MMs01727442
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724818![]() | s1cccc1C(c1sccc1)=C1CC(OC)C[N+](C1)(C)C | 1.00 |
MMs01727442![]() | s1cccc1C(c1sccc1)=C1CC(OC)C[N+](C1)(C)C | 1.00 |
MMs01724819![]() | s1cccc1C(c1sccc1)=C1CCC[NH+](C1)C | 0.82 |
MMs01725182![]() | s1ccc(C)c1C(=CCCN1CC(CCC1)C(O)=O)c1sccc1C | 0.73 |
MMs01727430![]() | s1ccc(C)c1C(=CCCN1CC(CCC1)C(O)=O)c1sccc1C | 0.73 |