Drugs present in MMsINC which are similar to the molecule MMscode: MMs01727373
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727376![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 1.00 |
MMs01727375![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 1.00 |
MMs01727374![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 1.00 |
MMs01727373![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 1.00 |
MMs01726428![]() | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.90 |
MMs01726429![]() | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.90 |
MMs01726430![]() | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.90 |
MMs01726431![]() | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.90 |
MMs01727122![]() | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.70 |
MMs01727120![]() | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.70 |
MMs01727118![]() | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.70 |
MMs01727116![]() | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.70 |