Drugs present in MMsINC which are similar to the molecule MMscode: MMs01725907
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725901 | Clc1ccccc1C1C(C(OC)=O)C(=NC(COCCN)=C1C(OCC)=O)C | 1.00 |
MMs01725993 | Clc1ccccc1C1C(C(OC)=O)C(=NC(COCCN)=C1C(OCC)=O)C | 1.00 |
MMs01725194 | Clc1c(cccc1Cl)C1C(C(OCC)=O)C(=NC(C)=C1C(OC)=O)C | 0.89 |
MMs01725198 | O(C(=O)C=1C(C(C(OC)=O)C(=NC=1C)C)c1cc([N+](=O)[O-])ccc1)CC | 0.73 |
MMs01727124 | O(C(=O)C=1C(C(C(OC)=O)C(=NC=1C)C)c1cc([N+](=O)[O-])ccc1)CCN(Cc1ccccc1)C | 0.72 |