Drugs present in MMsINC which are similar to the molecule MMscode: MMs01725855
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725855 | O=C1NC(=O)NC(=O)C1(CC)C=1CCCCC=1 | 1.00 |
MMs01725731 | O=C1NC(=O)NC(=O)C1(C(CCC)C)CC=C | 0.84 |
MMs01725732 | O=C1NC(=O)NC(=O)C1(C(CCC)C)CC=C | 0.84 |
MMs01726136 | O=C1NC(=O)NC(=O)C1(CC(C)C)CC=C | 0.82 |
MMs01725802 | O=C1NC(=O)NC(=O)C1(C(CC)C)CC=C | 0.81 |
MMs01727397 | O=C1NC(=O)NC(=O)C1(C(CC)C)CC=C | 0.81 |
MMs01725850 | O=C1NC(=O)NC(=O)C1(C(C)C)CC=C | 0.76 |
MMs01725405 | O=C1NC(=O)NC(=O)C1(C(CCC)C)CC | 0.74 |
MMs01725856 | O=C1NC(=O)NC(=O)C1(C(CC)C)CC | 0.72 |