Drugs present in MMsINC which are similar to the molecule MMscode: MMs01725479
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725479 | s1cc(nc1N)/C(=N\OC(C(O)=O)(C)C)/C(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 1.00 |
MMs01725846 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.82 |
MMs01725842 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.82 |
MMs01725844 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.82 |
MMs01726233 | s1cc(nc1N)/C(=N/OCC(O)=O)/C(=O)NC1C2SCC(C=C)=C(N2C1=O)C(O)=O | 0.75 |
MMs01726231 | s1cc(nc1N)/C(=N/OCC(O)=O)/C(=O)NC1C2SCC(C=C)=C(N2C1=O)C(O)=O | 0.75 |
MMs01726253 | s1c(CC(O)=O)c(nc1SCC=1CSC2N(C(=O)C2NC(=O)\C(=N\OC)\c2nc(sc2)N)C=1C(O)=O)C | 0.73 |
MMs01726255 | s1c(CC(O)=O)c(nc1SCC=1CSC2N(C(=O)C2NC(=O)\C(=N\OC)\c2nc(sc2)N)C=1C(O)=O)C | 0.73 |
MMs01726251 | s1c(CC(O)=O)c(nc1SCC=1CSC2N(C(=O)C2NC(=O)\C(=N\OC)\c2nc(sc2)N)C=1C(O)=O)C | 0.73 |
MMs01725821 | S1C2N(C(=O)C2NC(=O)C(S(O)(=O)=O)c2ccccc2)C(C(O)=O)=C(C1)C[n+]1ccc(cc1)C(=O)N | 0.73 |
MMs01725481 | s1cc(nc1N)/C(=N/OC)/C(=O)NC1C2SCC=C(N2C1=O)C(O)=O | 0.70 |