Drugs present in MMsINC which are similar to the molecule MMscode: MMs01725319
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724812 | Clc1cc2NC(NC(=O)c2cc1S(=O)(=O)N)CC | 1.00 |
MMs01725853 | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC1CCCC1 | 0.75 |
MMs01725799 | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC(C)C | 0.75 |
MMs01725065 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.72 |
MMs01725067 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.72 |