Drugs present in MMsINC which are similar to the molecule MMscode: MMs01724985
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724984 | s1c2Nc3c(N=C(N4CC[NH+](CC4)C)c2cc1C)cccc3 | 0.99 |
MMs01724862 | Clc1cc2c(Sc3c(N=C2N2CC[NH+](CC2)C)cccc3)cc1 | 0.75 |
MMs01724865 | Clc1cc2N=C(N3CC[NH+](CC3)C)c3c(Nc2cc1)cccc3 | 0.74 |
MMs01724778 | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.71 |
MMs01725302 | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.71 |
MMs01724864 | Clc1ccccc1C1=NCC(=O)N(c2sc(cc12)CC)C | 0.70 |