Drugs present in MMsINC which are similar to the molecule MMscode: MMs01724984
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724862 | Clc1cc2c(Sc3c(N=C2N2CC[NH+](CC2)C)cccc3)cc1 | 0.75 |
MMs01724865 | Clc1cc2N=C(N3CC[NH+](CC3)C)c3c(Nc2cc1)cccc3 | 0.74 |
MMs01724778 | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.72 |
MMs01724823 | S1c2c(N(c3c1cccc3)CC(C[NH+](C)C)C)cccc2 | 0.71 |
MMs01725055 | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.71 |