Drugs present in MMsINC which are similar to the molecule MMscode: MMs01724936
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724935![]() | S(=O)(=O)(N)c1ccc(N2S(=O)(=O)CCCC2)cc1 | 0.97 |
MMs01725656![]() | S(=O)(=O)(c1ccc(NCS(O)=O)cc1)c1ccc(NCS(O)=O)cc1 | 0.81 |
MMs01724792![]() | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.75 |
MMs01725796![]() | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.75 |
MMs01726784![]() | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.74 |
MMs01726782![]() | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.74 |
MMs01725345![]() | S(=O)(=O)(N)c1cc2S(=O)(=O)NC(Nc2cc1C(F)(F)F)Cc1ccccc1 | 0.72 |
MMs01725223![]() | S(=O)(=O)(N)c1cc2S(=O)(=O)NC(Nc2cc1C(F)(F)F)Cc1ccccc1 | 0.72 |
MMs01727428![]() | S1c2c(N(c3c1cccc3)CCCN1CCN(CC1)C)cc(S(=O)(=O)N(C)C)cc2 | 0.72 |
MMs01726935![]() | S1c2c(N(c3c1cccc3)CCC1N(CCCC1)C)cc(S(=O)C)cc2 | 0.71 |
MMs01726933![]() | S1c2c(N(c3c1cccc3)CCC1N(CCCC1)C)cc(S(=O)C)cc2 | 0.71 |
MMs01725233![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC(C)C | 0.71 |
MMs01725353![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)C(Cl)Cl | 0.71 |
MMs01725355![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)C(Cl)Cl | 0.71 |
MMs01725799![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC(C)C | 0.71 |
MMs01725351![]() | Clc1cc2NC(N(S(=O)(=O)c2cc1S(=O)(=O)N)C)CCl | 0.70 |
MMs01725349![]() | Clc1cc2NC(N(S(=O)(=O)c2cc1S(=O)(=O)N)C)CCl | 0.70 |
MMs01725953![]() | S(=O)(=O)(c1ccc(N)cc1S(=O)(=O)NC(=O)C)c1ccc(N)cc1 | 0.70 |