Drugs present in MMsINC which are similar to the molecule MMscode: MMs01724924
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725160![]() | Clc1cc2c(N(CC(F)(F)F)C(=O)CN=C2c2ccccc2)cc1 | 0.94 |
MMs01724746![]() | Clc1cc2c(N(CCO)C(=O)C(O)N=C2c2ccccc2F)cc1 | 0.87 |
MMs01727141![]() | O=C1N(c2c(cc([N+](=O)[O-])cc2)C(=NC1)c1ccccc1)C | 0.80 |
MMs01725163![]() | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.78 |
MMs01724864![]() | Clc1ccccc1C1=NCC(=O)N(c2sc(cc12)CC)C | 0.75 |
MMs01724865![]() | Clc1cc2N=C(N3CC[NH+](CC3)C)c3c(Nc2cc1)cccc3 | 0.75 |
MMs01725819![]() | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.73 |
MMs01726498![]() | Clc1ccccc1C12N(CC(=O)Nc3c1cc(Cl)cc3)COC2 | 0.70 |
MMs01726499![]() | Clc1ccccc1C12N(CC(=O)Nc3c1cc(Cl)cc3)COC2 | 0.70 |