Drugs present in MMsINC which are similar to the molecule MMscode: MMs01724909
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725160![]() | Clc1cc2c(N(CC(F)(F)F)C(=O)CN=C2c2ccccc2)cc1 | 0.82 |
MMs01724921![]() | Clc1cc2c(N(CC#C)C(=O)CN=C2c2ccccc2)cc1 | 0.80 |
MMs01724924![]() | Clc1cc2c(N(CC3CC3)C(=O)CN=C2c2ccccc2)cc1 | 0.79 |
MMs01726644![]() | Clc1cc2c(N(CCO)C(=O)C(O)N=C2c2ccccc2F)cc1 | 0.77 |
MMs01724746![]() | Clc1cc2c(N(CCO)C(=O)C(O)N=C2c2ccccc2F)cc1 | 0.77 |
MMs01724834![]() | Clc1cc2c(-n3c(nnc3C)CN=C2c2ccccc2)cc1 | 0.76 |
MMs01724884![]() | Clc1cc2c(-n3c(nnc3)CN=C2c2ccccc2)cc1 | 0.76 |
MMs01724926![]() | O=C1N=C(c2c(N1C(C)C)cc(cc2)C)c1ccccc1 | 0.74 |
MMs01724907![]() | Clc1cc2c(-n3c(CN=C2c2ccccc2F)c[nH+]c3C)cc1 | 0.73 |
MMs01724865![]() | Clc1cc2N=C(N3CC[NH+](CC3)C)c3c(Nc2cc1)cccc3 | 0.73 |