Drugs present in MMsINC which are similar to the molecule MMscode: MMs01724896
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724895 | Oc1cc(ccc1\C=C\c1ccc(cc1)C(N)=N)C(N)=N | 1.00 |
MMs01725559 | O(CCCCCOc1ccc(cc1)C(N)=N)c1ccc(cc1)C(N)=N | 0.77 |
MMs01725668 | Oc1ccc(cc1)CC(N)C | 0.72 |
MMs01724965 | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.70 |
MMs01725077 | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.70 |
MMs01725376 | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.70 |
MMs01726603 | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.70 |
MMs01726605 | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.70 |
MMs01726607 | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.70 |