Drugs present in MMsINC which are similar to the molecule MMscode: MMs01704522
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724755 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.77 |
MMs01725336 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.77 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.74 |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.74 |
MMs01725302 | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.72 |
MMs01724778 | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.72 |
MMs01724864 | Clc1ccccc1C1=NCC(=O)N(c2sc(cc12)CC)C | 0.72 |
MMs01724969 | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.71 |
MMs01725055 | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.71 |
MMs01726915 | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2C | 0.71 |
MMs01724984 | s1c2Nc3c(N=C(N4CC[NH+](CC4)C)c2cc1C)cccc3 | 0.71 |
MMs01725300 | S1c2c(N(c3c1cccc3)CC(C[NH+](C)C)C)cccc2 | 0.70 |
MMs01724823 | S1c2c(N(c3c1cccc3)CC(C[NH+](C)C)C)cccc2 | 0.70 |