Drugs present in MMsINC which are similar to the molecule MMscode: MMs01697534
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725455 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.78 |
MMs01725771 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.78 |
MMs01725866 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.78 |
MMs01726044 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.78 |
MMs01724755 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.77 |
MMs01725336 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.77 |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.73 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.73 |
MMs01726383 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)C | 0.71 |
MMs01726385 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)C | 0.71 |
MMs01725483 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)C | 0.71 |
MMs01726381 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)C | 0.71 |
MMs01726387 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)COC(=O)C | 0.70 |
MMs01726389 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)COC(=O)C | 0.70 |
MMs01726391 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)COC(=O)C | 0.70 |
MMs01726393 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)COC(=O)C | 0.70 |