Drugs present in MMsINC which are similar to the molecule MMscode: MMs01692543
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.75 |
MMs01725425 | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.73 |
MMs01727531 | S1c2c(cc(S(=O)(=O)N(C)C)cc2)\C(\c2c1cccc2)=C\CCN1CCN(CC1)C | 0.72 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.72 |
MMs01724782 | [NH+]1(CC2N(CC1)c1c(Cc3c2cccc3)cccc1)C | 0.72 |
MMs01726941 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.71 |
MMs01724788 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.71 |
MMs01725632 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.71 |