Drugs present in MMsINC which are similar to the molecule MMscode: MMs01687307
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725619 | O(C(=O)C(C)C)c1cc(ccc1OC(=O)C(C)C)CCNC | 0.73 |
MMs01725361 | O1Cc2c(cccc2)/C(/c2cc(ccc12)CC(O)=O)=C\CCN(C)C | 0.72 |
MMs01724973 | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.72 |
MMs01725388 | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.72 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.72 |
MMs01724855 | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.71 |
MMs01725838 | O(C)c1cc2C34C(C(N(CC3)C)Cc2cc1)CCCC4 | 0.71 |
MMs01725260 | O(C(=O)C)c1ccc(cc1)C(c1ccc(OC(=O)C)cc1)=C1CCCCC1 | 0.71 |
MMs01726665 | O(C)c1cc2c(cc1OC)CCNC2CC1CC2N(CC1CC)CCc1cc(OC)c(OC)cc12 | 0.71 |
MMs01726667 | O(C)c1cc2c(cc1OC)CCNC2CC1CC2N(CC1CC)CCc1cc(OC)c(OC)cc12 | 0.71 |
MMs01727514 | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.71 |
MMs01727510 | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.71 |
MMs01727512 | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.71 |
MMs01727513 | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.71 |
MMs01725084 | O(C(=O)C)c1cc(C(C)C)c(OCCN(C)C)cc1C | 0.70 |