Drugs present in MMsINC which are similar to the molecule MMscode: MMs01674006
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725073 | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.81 |
MMs01725075 | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.81 |
MMs01724790 | OCc1cc2CCC(Nc2cc1[N+](=O)[O-])CNC(C)C | 0.73 |
MMs01725317 | OCc1cc2CCC(Nc2cc1[N+](=O)[O-])CNC(C)C | 0.73 |
MMs01725775 | Clc1cc(-c2cc(Cl)cc([N+](=O)[O-])c2O)c(O)c([N+](=O)[O-])c1 | 0.72 |