Drugs present in MMsINC which are similar to the molecule MMscode: MMs01633167
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726782 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.75 |
MMs01726784 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.75 |
MMs01727428 | S1c2c(N(c3c1cccc3)CCCN1CCN(CC1)C)cc(S(=O)(=O)N(C)C)cc2 | 0.74 |
MMs01724792 | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.70 |
MMs01725796 | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.70 |