Drugs present in MMsINC which are similar to the molecule MMscode: MMs01577229
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724870 | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.76 |
MMs01724731 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.75 |
MMs01726487 | Clc1ccc(OC(C(OCCCC(=O)N(C)C)=O)(C)C)cc1 | 0.74 |
MMs01725487 | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.72 |
MMs01725169 | Clc1ccc(OC(C(=O)NC(=O)NCN2CCOCC2)(C)C)cc1 | 0.71 |
MMs01724736 | Clc1ccc(OCC(O)COC(=O)N)cc1 | 0.70 |