Drugs present in MMsINC which are similar to the molecule MMscode: MMs01565311
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725182 | s1ccc(C)c1C(=CCCN1CC(CCC1)C(O)=O)c1sccc1C | 0.76 |
MMs01727430 | s1ccc(C)c1C(=CCCN1CC(CCC1)C(O)=O)c1sccc1C | 0.76 |
MMs01724818 | s1cccc1C(c1sccc1)=C1CC(OC)C[N+](C1)(C)C | 0.71 |
MMs01727442 | s1cccc1C(c1sccc1)=C1CC(OC)C[N+](C1)(C)C | 0.71 |
MMs01725161 | O1CCN(CC1)CC(C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1)C | 0.70 |
MMs01725769 | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.70 |