Drugs present in MMsINC which are similar to the molecule MMscode: MMs01555343
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724832 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.83 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.79 |
MMs01725067 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.76 |
MMs01725065 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.76 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.74 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.74 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.73 |