Drugs present in MMsINC which are similar to the molecule MMscode: MMs01536069
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725092 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.72 |
MMs01725094 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.72 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.72 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.72 |
MMs01725769 | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.71 |