Drugs present in MMsINC which are similar to the molecule MMscode: MMs01534824
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.74 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.74 |
MMs01725319 | Clc1cc2NC(NC(=O)c2cc1S(=O)(=O)N)CC | 0.73 |
MMs01724812 | Clc1cc2NC(NC(=O)c2cc1S(=O)(=O)N)CC | 0.73 |
MMs01726941 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.72 |
MMs01725217 | Fc1ccc(cc1)C(=O)CCCN1CCC(N2c3c(NC2=O)cccc3)=CC1 | 0.71 |
MMs01724935 | S(=O)(=O)(N)c1ccc(N2S(=O)(=O)CCCC2)cc1 | 0.71 |
MMs01725223 | S(=O)(=O)(N)c1cc2S(=O)(=O)NC(Nc2cc1C(F)(F)F)Cc1ccccc1 | 0.70 |
MMs01725345 | S(=O)(=O)(N)c1cc2S(=O)(=O)NC(Nc2cc1C(F)(F)F)Cc1ccccc1 | 0.70 |