Drugs present in MMsINC which are similar to the molecule MMscode: MMs01530344
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725747![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.74 |
MMs01725749![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.74 |
MMs01724873![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.74 |
MMs01725745![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.74 |
MMs01725525![]() | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.73 |
MMs01725524![]() | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.73 |
MMs01725596![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725733![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725734![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725735![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.70 |
MMs01725309![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.70 |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.70 |