Drugs present in MMsINC which are similar to the molecule MMscode: MMs01515365
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725080 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.74 |
MMs01725081 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.74 |
MMs01724775 | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.73 |
MMs01724772 | O1C(CNC1=O)COc1ccccc1OC | 0.71 |
MMs01725806 | O1C(CNC1=O)COc1ccccc1OC | 0.71 |