Drugs present in MMsINC which are similar to the molecule MMscode: MMs01479746
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724832![]() | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.84 |
MMs01725545![]() | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.82 |
MMs01725067![]() | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.80 |
MMs01725065![]() | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.80 |
MMs01725784![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.74 |
MMs01725782![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.74 |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.72 |
MMs01724744![]() | O=C(C(N(CC)CC)C)c1ccccc1 | 0.70 |










