Drugs present in MMsINC which are similar to the molecule MMscode: MMs01443816
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724967![]() | S(=O)(=O)(NC)CCc1cc2c([nH]cc2C2CCN(CC2)C)cc1 | 0.72 |
MMs01727286![]() | [n+]1(c2c(cc(N(C)C)cc2)ccc1\C=C\c1cc(n(c1C)-c1ccccc1)C)C | 0.72 |
MMs01724990![]() | S(=O)(=O)(NC(=O)NC(C)C)c1cnccc1Nc1cc(ccc1)C | 0.71 |
MMs01724798![]() | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.71 |
MMs01725150![]() | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.71 |
MMs01725019![]() | S(=O)(=O)(NC)Cc1cc2c([nH]cc2CCN(C)C)cc1 | 0.70 |