Drugs present in MMsINC which are similar to the molecule MMscode: MMs01431054
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727463![]() | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.76 |
MMs01727365![]() | O(CC(O)=O)c1cc(OCC=C(C)C)ccc1C(=O)\C=C\c1ccc(OCC=C(C)C)cc1 | 0.74 |
MMs01725187![]() | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.74 |
MMs01725546![]() | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.72 |
MMs01725170![]() | s1c2c(ccc(O)c2)c(C(=O)c2ccc(OCCN3CCCCC3)cc2)c1-c1ccc(O)cc1 | 0.71 |







