Drugs present in MMsINC which are similar to the molecule MMscode: MMs01428125
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.77 |
MMs01725370![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.77 |
MMs01724832![]() | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.76 |
MMs01726941![]() | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.73 |
MMs01727509![]() | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.72 |
MMs01725592![]() | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.72 |
MMs01725593![]() | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.72 |
MMs01725336![]() | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.71 |
MMs01724755![]() | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.71 |