Drugs present in MMsINC which are similar to the molecule MMscode: MMs01378626
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724735 | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.81 |
MMs01725288 | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.81 |
MMs01725221 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.76 |
MMs01726924 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.76 |
MMs01725575 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1ccc(cc1)C(C)(C)C)c1ccccc1 | 0.73 |
MMs01725577 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1ccc(cc1)C(C)(C)C)c1ccccc1 | 0.73 |