Drugs present in MMsINC which are similar to the molecule MMscode: MMs01369484
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725691 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.77 |
MMs01725517 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.77 |
MMs01726905 | Ic1cc(cc(I)c1Oc1cc(I)c(O)cc1)CC(N)C(O)=O | 0.73 |
MMs01726903 | Ic1cc(cc(I)c1Oc1cc(I)c(O)c(I)c1)CC(N)C(O)=O | 0.72 |
MMs01726904 | Ic1cc(cc(I)c1Oc1cc(I)c(O)c(I)c1)CC(N)C(O)=O | 0.72 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.71 |
MMs01725292 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.71 |