Drugs present in MMsINC which are similar to the molecule MMscode: MMs01351234
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725384 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.76 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.72 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.72 |
MMs01725777 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.72 |
MMs01725104 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.72 |
MMs01725143 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.72 |
MMs01724784 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.72 |