Drugs present in MMsINC which are similar to the molecule MMscode: MMs01349250
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725163![]() | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.79 |
MMs01725237![]() | Clc1cccc(NC(=O)c2ccccc2)c1CN(CC(=O)N1CCOCC1)C | 0.78 |
MMs01725625![]() | Clc1ccc(cc1)C(=O)CN(CCCN1c2c(CCc3c1cccc3)cccc2)C | 0.77 |
MMs01726915![]() | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2C | 0.73 |
MMs01725319![]() | Clc1cc2NC(NC(=O)c2cc1S(=O)(=O)N)CC | 0.71 |
MMs01724812![]() | Clc1cc2NC(NC(=O)c2cc1S(=O)(=O)N)CC | 0.71 |
MMs01725438![]() | [NH+](CCCN1c2c(cccc2)C(c2c1cccc2)(C)C)(C)C | 0.70 |