Drugs present in MMsINC which are similar to the molecule MMscode: MMs01346507
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725433![]() | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.73 |
MMs01725794![]() | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.73 |
MMs01725715![]() | O(CCCN(C)C)C1(CCCCCC1)Cc1ccccc1 | 0.72 |
MMs01725386![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725387![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725440![]() | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.72 |
MMs01725427![]() | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.71 |
MMs01725733![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725734![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725735![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725511![]() | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.70 |
MMs01725513![]() | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.70 |