Drugs present in MMsINC which are similar to the molecule MMscode: MMs01344295
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725163![]() | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.77 |
MMs01725625![]() | Clc1ccc(cc1)C(=O)CN(CCCN1c2c(CCc3c1cccc3)cccc2)C | 0.77 |
MMs01725237![]() | Clc1cccc(NC(=O)c2ccccc2)c1CN(CC(=O)N1CCOCC1)C | 0.77 |
MMs01725059![]() | S1c2c(N(c3c1cccc3)CCCN(C)C)cc(cc2)C(=O)C | 0.71 |
MMs01724810![]() | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(cc2)C(=O)CC | 0.71 |
MMs01725321![]() | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(cc2)C(=O)CC | 0.71 |
MMs01725254![]() | S1c2c(N(c3c1cccc3)CCCN1CCN(CC1)C)cc(cc2)C(=O)CCC | 0.70 |
MMs01726915![]() | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2C | 0.70 |