Drugs present in MMsINC which are similar to the molecule MMscode: MMs01338945
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725364![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.75 |
MMs01725362![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.75 |
MMs01724830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.75 |
MMs01725830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.75 |
MMs01724842![]() | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.73 |
MMs01724733![]() | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.73 |
MMs01725286![]() | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.73 |
MMs01725461![]() | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.70 |
MMs01725463![]() | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.70 |
MMs01725329![]() | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.70 |
MMs01724802![]() | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.70 |