Drugs present in MMsINC which are similar to the molecule MMscode: MMs01321181
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725077![]() | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.81 |
MMs01725448![]() | Oc1cc(ccc1O)CC(N)C(O)=O | 0.74 |
MMs01727173![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.73 |
MMs01727171![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.73 |
MMs01727169![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.73 |
MMs01725130![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.73 |
MMs01724767![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.70 |
MMs01725137![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.70 |
MMs01725139![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.70 |
MMs01725763![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |
MMs01725761![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |
MMs01725759![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |
MMs01725757![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |